C29H33N3O9 — CID 70472833
dimethyl 4-[2-[4-[[2-(4-hydroxyphenyl)acetyl]amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70472833) has the molecular formula C29H33N3O9 and a molecular weight of 567.60 g/mol. Its IUPAC name is dimethyl 4-[2-[4-[[2-(4-hydroxyphenyl)acetyl]amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[2-[4-[[2-(4-hydroxyphenyl)acetyl]amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70472833 |
| Molecular Formula | C29H33N3O9 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | dimethyl 4-[2-[4-[[2-(4-hydroxyphenyl)acetyl]amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cc([N+](=O)[O-])ccc1OCCCCNC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C29H33N3O9/c1-17-25(28(35)39-3)27(26(18(2)31-17)29(36)40-4)22-16-20(32(37)38)9-12-23(22)41-14-6-5-13-30-24(34)15-19-7-10-21(33)11-8-19/h7-12,16,27,31,33H,5-6,13-15H2,1-4H3,(H,30,34) |
| InChIKey | ZEOIWOLWRPFVHE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|