C21H23ClN2O7 — CID 14050497
dimethyl 4-[2-[(E)-4-chlorobut-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 14050497) has the molecular formula C21H23ClN2O7 and a molecular weight of 450.88 g/mol. Its IUPAC name is dimethyl 4-[2-[(E)-4-chlorobut-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[2-[(E)-4-chlorobut-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14050497 |
| Molecular Formula | C21H23ClN2O7 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | dimethyl 4-[2-[(E)-4-chlorobut-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cc([N+](=O)[O-])ccc1OC/C=C/CCl |
| InChI | InChI=1S/C21H23ClN2O7/c1-12-17(20(25)29-3)19(18(13(2)23-12)21(26)30-4)15-11-14(24(27)28)7-8-16(15)31-10-6-5-9-22/h5-8,11,19,23H,9-10H2,1-4H3/b6-5+ |
| InChIKey | DFTQTYZNVBLMNS-AATRIKPKSA-N |
| XLogP | 3.35 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|