C30H35N3O9 — CID 70420057
dimethyl 4-[2-[(Z)-1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70420057) has the molecular formula C30H35N3O9 and a molecular weight of 581.62 g/mol. Its IUPAC name is dimethyl 4-[2-[(Z)-1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[2-[(Z)-1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70420057 |
| Molecular Formula | C30H35N3O9 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | dimethyl 4-[2-[(Z)-1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-enoxy]-5-nitrophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C/C=C\C(NCC(O)COc1ccccc1)Oc1ccc([N+](=O)[O-])cc1C1C(C(=O)OC)=C(C)NC(C)=C1C(=O)OC |
| InChI | InChI=1S/C30H35N3O9/c1-6-10-25(31-16-21(34)17-41-22-11-8-7-9-12-22)42-24-14-13-20(33(37)38)15-23(24)28-26(29(35)39-4)18(2)32-19(3)27(28)30(36)40-5/h6-15,21,25,28,31-32,34H,16-17H2,1-5H3/b10-6- |
| InChIKey | FPJZREPTHZRCRI-POHAHGRESA-N |
| XLogP | 3.49 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|