C29H32N2O8 — CID 70419666
4-[2-[1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-ynoxy]-5-methoxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70419666) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is 4-[2-[1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-ynoxy]-5-methoxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-[1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-ynoxy]-5-methoxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70419666 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 4-[2-[1-[(2-hydroxy-3-phenoxypropyl)amino]but-2-ynoxy]-5-methoxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC#CC(NCC(O)COc1ccccc1)Oc1ccc(OC)cc1C1C(C(=O)O)=C(C)NC(C)=C1C(=O)O |
| InChI | InChI=1S/C29H32N2O8/c1-5-9-24(30-15-19(32)16-38-20-10-7-6-8-11-20)39-23-13-12-21(37-4)14-22(23)27-25(28(33)34)17(2)31-18(3)26(27)29(35)36/h6-8,10-14,19,24,27,30-32H,15-16H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | YPKBKIKEEQUORX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|