C29H34N2O8S — CID 70419680
4-[2-[4-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]but-2-enoxy]-5-methylsulfinylphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70419680) has the molecular formula C29H34N2O8S and a molecular weight of 570.66 g/mol. Its IUPAC name is 4-[2-[4-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]but-2-enoxy]-5-methylsulfinylphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-[4-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]but-2-enoxy]-5-methylsulfinylphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70419680 |
| Molecular Formula | C29H34N2O8S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 4-[2-[4-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]but-2-enoxy]-5-methylsulfinylphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cc(S(C)=O)ccc2OCC=CCNC[C@H](O)COc2ccccc2)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C29H34N2O8S/c1-18-25(28(33)34)27(26(29(35)36)19(2)31-18)23-15-22(40(3)37)11-12-24(23)38-14-8-7-13-30-16-20(32)17-39-21-9-5-4-6-10-21/h4-12,15,20,27,30-32H,13-14,16-17H2,1-3H3,(H,33,34)(H,35,36)/t20-,40?/m0/s1 |
| InChIKey | PPWUFHSNIHCHQS-SMOCLIFKSA-N |
| XLogP | 2.79 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|