C34H45N3O11 — CID 70472962
3-O-ethyl 5-O-methyl 2-[2-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethoxy]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70472962) has the molecular formula C34H45N3O11 and a molecular weight of 671.74 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-[2-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethoxy]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-[2-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethoxy]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70472962 |
| Molecular Formula | C34H45N3O11 |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-[2-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethoxy]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCOCCOc2ccc(OCC(O)CNC(C)C)cc2)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H45N3O11/c1-6-46-34(40)32-29(36-23(4)30(33(39)43-5)31(32)24-8-7-9-25(18-24)37(41)42)21-45-15-14-44-16-17-47-27-10-12-28(13-11-27)48-20-26(38)19-35-22(2)3/h7-13,18,22,26,31,35-36,38H,6,14-17,19-21H2,1-5H3 |
| InChIKey | UDVIXKODZBUWRB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 176.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|