C31H36N2O11 — CID 88691925
5-O-ethyl 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-[2-[2-[4-(oxiran-2-ylmethoxy)phenoxy]ethoxy]ethoxymethyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88691925) has the molecular formula C31H36N2O11 and a molecular weight of 612.63 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-[2-[2-[4-(oxiran-2-ylmethoxy)phenoxy]ethoxy]ethoxymethyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-[2-[2-[4-(oxiran-2-ylmethoxy)phenoxy]ethoxy]ethoxymethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88691925 |
| Molecular Formula | C31H36N2O11 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-[2-[2-[4-(oxiran-2-ylmethoxy)phenoxy]ethoxy]ethoxymethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCOCCOc2ccc(OCC3CO3)cc2)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H36N2O11/c1-4-41-31(35)29-26(32-20(2)27(30(34)38-3)28(29)21-6-5-7-22(16-21)33(36)37)19-40-13-12-39-14-15-42-23-8-10-24(11-9-23)43-17-25-18-44-25/h5-11,16,25,28,32H,4,12-15,17-19H2,1-3H3 |
| InChIKey | FUTYVSQTVOBIIQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|