C29H28N4O9 — CID 23185641
3-O-methyl 5-O-[2-[[2-[4-(oxiran-2-ylmethoxy)phenyl]acetyl]amino]ethyl] 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 23185641) has the molecular formula C29H28N4O9 and a molecular weight of 576.56 g/mol. Its IUPAC name is 3-O-methyl 5-O-[2-[[2-[4-(oxiran-2-ylmethoxy)phenyl]acetyl]amino]ethyl] 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[2-[[2-[4-(oxiran-2-ylmethoxy)phenyl]acetyl]amino]ethyl] 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23185641 |
| Molecular Formula | C29H28N4O9 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 3-O-methyl 5-O-[2-[[2-[4-(oxiran-2-ylmethoxy)phenyl]acetyl]amino]ethyl] 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C#N)NC(C)=C(C(=O)OCCNC(=O)Cc2ccc(OCC3CO3)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H28N4O9/c1-17-25(26(19-4-3-5-20(13-19)33(37)38)27(28(35)39-2)23(14-30)32-17)29(36)40-11-10-31-24(34)12-18-6-8-21(9-7-18)41-15-22-16-42-22/h3-9,13,22,26,32H,10-12,15-16H2,1-2H3,(H,31,34) |
| InChIKey | QJFAZZOPEQPMTI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 182.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|