C20H20F3N3O7 — CID 46887925
3-O-methyl 5-O-[2-[(2,2,2-trifluoroacetyl)amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 46887925) has the molecular formula C20H20F3N3O7 and a molecular weight of 471.39 g/mol. Its IUPAC name is 3-O-methyl 5-O-[2-[(2,2,2-trifluoroacetyl)amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[2-[(2,2,2-trifluoroacetyl)amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 46887925 |
| Molecular Formula | C20H20F3N3O7 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 3-O-methyl 5-O-[2-[(2,2,2-trifluoroacetyl)amino]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCNC(=O)C(F)(F)F)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20F3N3O7/c1-10-14(17(27)32-3)16(12-5-4-6-13(9-12)26(30)31)15(11(2)25-10)18(28)33-8-7-24-19(29)20(21,22)23/h4-6,9,16,25H,7-8H2,1-3H3,(H,24,29) |
| InChIKey | VHQGCYKOTXYZFM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|