C37H46N6O6 — CID 70435895
bis[3-(2-anilinoethylamino)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70435895) has the molecular formula C37H46N6O6 and a molecular weight of 670.81 g/mol. Its IUPAC name is bis[3-(2-anilinoethylamino)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[3-(2-anilinoethylamino)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70435895 |
| Molecular Formula | C37H46N6O6 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | bis[3-(2-anilinoethylamino)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCNCCNc2ccccc2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCCNCCNc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C37H46N6O6/c1-27-33(36(44)48-24-10-18-38-20-22-40-30-13-5-3-6-14-30)35(29-12-9-17-32(26-29)43(46)47)34(28(2)42-27)37(45)49-25-11-19-39-21-23-41-31-15-7-4-8-16-31/h3-9,12-17,26,35,38-42H,10-11,18-25H2,1-2H3 |
| InChIKey | OBBMYARROVVZFT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|