C24H19F13N2O6 — CID 88617515
2,6-dimethyl-4-(3-nitrophenyl)-5-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 88617515) has the molecular formula C24H19F13N2O6 and a molecular weight of 678.40 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-nitrophenyl)-5-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 2,6-dimethyl-4-(3-nitrophenyl)-5-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 88617515 |
| Molecular Formula | C24H19F13N2O6 |
| Molecular Weight | 678.40 g/mol |
| Exact Mass | 678.10 |
| IUPAC Name | 2,6-dimethyl-4-(3-nitrophenyl)-5-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C(C)N1 |
| InChI | InChI=1S/C24H19F13N2O6/c1-10-14(17(40)41)16(12-5-3-6-13(9-12)39(43)44)15(11(2)38-10)18(42)45-8-4-7-19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h3,5-6,9,16,38H,4,7-8H2,1-2H3,(H,40,41) |
| InChIKey | CHNMBPXEMVAJLM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.40 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|