C17H15F3N2O6 — CID 139664237
5-ethoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 139664237) has the molecular formula C17H15F3N2O6 and a molecular weight of 400.31 g/mol. Its IUPAC name is 5-ethoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-ethoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139664237 |
| Molecular Formula | C17H15F3N2O6 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 5-ethoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15F3N2O6/c1-3-28-16(25)13-12(9-5-4-6-10(7-9)22(26)27)11(15(23)24)8(2)21-14(13)17(18,19)20/h4-7,12,21H,3H2,1-2H3,(H,23,24) |
| InChIKey | YCKZHNVUKJCEDB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|