C26H24F3N3O6 — CID 70060736
5-O-[2-(1,3-dihydroisoindol-2-yl)ethyl] 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70060736) has the molecular formula C26H24F3N3O6 and a molecular weight of 531.49 g/mol. Its IUPAC name is 5-O-[2-(1,3-dihydroisoindol-2-yl)ethyl] 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(1,3-dihydroisoindol-2-yl)ethyl] 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70060736 |
| Molecular Formula | C26H24F3N3O6 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 5-O-[2-(1,3-dihydroisoindol-2-yl)ethyl] 3-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C(F)(F)F)=C(C(=O)OCCN2Cc3ccccc3C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24F3N3O6/c1-15-20(24(33)37-2)21(16-8-5-9-19(12-16)32(35)36)22(23(30-15)26(27,28)29)25(34)38-11-10-31-13-17-6-3-4-7-18(17)14-31/h3-9,12,21,30H,10-11,13-14H2,1-2H3 |
| InChIKey | RWEOSPATDJTSBH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|