C37H42N4O7 — CID 25054141
5-O-[2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 25054141) has the molecular formula C37H42N4O7 and a molecular weight of 654.76 g/mol. Its IUPAC name is 5-O-[2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 25054141 |
| Molecular Formula | C37H42N4O7 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 5-O-[2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN2CCN(CCOC(c3ccccc3)c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H42N4O7/c1-26-32(36(42)46-3)34(30-15-10-16-31(25-30)41(44)45)33(27(2)38-26)37(43)48-24-22-40-19-17-39(18-20-40)21-23-47-35(28-11-6-4-7-12-28)29-13-8-5-9-14-29/h4-16,25,34-35,38H,17-24H2,1-3H3 |
| InChIKey | SYHQOGHRCHVBBT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|