C30H34N4O9 — CID 54096308
5-O-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54096308) has the molecular formula C30H34N4O9 and a molecular weight of 594.62 g/mol. Its IUPAC name is 5-O-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54096308 |
| Molecular Formula | C30H34N4O9 |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 5-O-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]ethyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C#N)=NC(C)=C(C(=O)OCCOc2ccc(OCC(O)CNC(C)C)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34N4O9/c1-18(2)32-16-22(35)17-43-24-10-8-23(9-11-24)41-12-13-42-30(37)26-19(3)33-25(15-31)28(29(36)40-4)27(26)20-6-5-7-21(14-20)34(38)39/h5-11,14,18,22,27-28,32,35H,12-13,16-17H2,1-4H3 |
| InChIKey | MXJBKZXMXIHJLN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 182.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|