C32H41N3O9 — CID 70471342
3-ethoxycarbonyl-1-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid (PubChem CID 70471342) has the molecular formula C32H41N3O9 and a molecular weight of 611.69 g/mol. Its IUPAC name is 3-ethoxycarbonyl-1-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid.
| Compound Name | 3-ethoxycarbonyl-1-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 70471342 |
| Molecular Formula | C32H41N3O9 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 3-ethoxycarbonyl-1-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid |
| SMILES | CCOC(=O)C1=C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(C)N(CCCOc2ccc(OCC(O)CNC(C)C)cc2)C1C |
| InChI | InChI=1S/C32H41N3O9/c1-6-42-32(39)29-22(5)34(21(4)28(31(37)38)30(29)23-9-7-10-24(17-23)35(40)41)15-8-16-43-26-11-13-27(14-12-26)44-19-25(36)18-33-20(2)3/h7,9-14,17,20,22,25,33,36H,6,8,15-16,18-19H2,1-5H3,(H,37,38) |
| InChIKey | AENOKNVVJFUCRW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 160.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|