C31H37N5O7 — CID 70471987
3-[5-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]pentylcarbamoyl]-1,2,6-trimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid (PubChem CID 70471987) has the molecular formula C31H37N5O7 and a molecular weight of 591.67 g/mol. Its IUPAC name is 3-[5-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]pentylcarbamoyl]-1,2,6-trimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid.
| Compound Name | 3-[5-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]pentylcarbamoyl]-1,2,6-trimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 70471987 |
| Molecular Formula | C31H37N5O7 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 3-[5-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]pentylcarbamoyl]-1,2,6-trimethyl-4-(3-nitrophenyl)-2H-pyridine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)=C(C(=O)NCCCCCNCC(O)COc2ccccc2C#N)C(C)N1C |
| InChI | InChI=1S/C31H37N5O7/c1-20-27(29(28(31(39)40)21(2)35(20)3)22-11-9-12-24(16-22)36(41)42)30(38)34-15-8-4-7-14-33-18-25(37)19-43-26-13-6-5-10-23(26)17-32/h5-6,9-13,16,20,25,33,37H,4,7-8,14-15,18-19H2,1-3H3,(H,34,38)(H,39,40) |
| InChIKey | UMZBMWYMSKDZIK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 178.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|