C14H20N2O4S — CID 61020873
2-[2-hydroxy-3-(3-methylsulfonylpropylamino)propoxy]benzonitrile (PubChem CID 61020873) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(3-methylsulfonylpropylamino)propoxy]benzonitrile.
| Compound Name | 2-[2-hydroxy-3-(3-methylsulfonylpropylamino)propoxy]benzonitrile |
|---|---|
| PubChem CID | 61020873 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[2-hydroxy-3-(3-methylsulfonylpropylamino)propoxy]benzonitrile |
| SMILES | CS(=O)(=O)CCCNCC(O)COc1ccccc1C#N |
| InChI | InChI=1S/C14H20N2O4S/c1-21(18,19)8-4-7-16-10-13(17)11-20-14-6-3-2-5-12(14)9-15/h2-3,5-6,13,16-17H,4,7-8,10-11H2,1H3 |
| InChIKey | FVCWJFFLGUDOCK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|