C18H21N3O4S — CID 13030966
N-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]benzenesulfonamide (PubChem CID 13030966) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 13030966 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1OCC(O)CNCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O4S/c19-12-15-6-4-5-9-18(15)25-14-16(22)13-20-10-11-21-26(23,24)17-7-2-1-3-8-17/h1-9,16,20-22H,10-11,13-14H2 |
| InChIKey | OVAXFDZMGQUODT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|