C13H17N3O4 — CID 106174965
3-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide (PubChem CID 106174965) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174965 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide |
| SMILES | N#Cc1ccccc1OCC(O)CNCC(O)C(N)=O |
| InChI | InChI=1S/C13H17N3O4/c14-5-9-3-1-2-4-12(9)20-8-10(17)6-16-7-11(18)13(15)19/h1-4,10-11,16-18H,6-8H2,(H2,15,19) |
| InChIKey | XQIQVYHEMKTKEK-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |