C12H14F2N2O2 — CID 113303744
2-[3-(2,2-difluoroethylamino)-2-hydroxypropoxy]benzonitrile (PubChem CID 113303744) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethylamino)-2-hydroxypropoxy]benzonitrile.
| Compound Name | 2-[3-(2,2-difluoroethylamino)-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 113303744 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[3-(2,2-difluoroethylamino)-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCC(O)CNCC(F)F |
| InChI | InChI=1S/C12H14F2N2O2/c13-12(14)7-16-6-10(17)8-18-11-4-2-1-3-9(11)5-15/h1-4,10,12,16-17H,6-8H2 |
| InChIKey | SZEGGVLKRGTLRQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |