C16H22N2O3 — CID 61039506
2-[2-hydroxy-3-[2-(oxolan-2-yl)ethylamino]propoxy]benzonitrile (PubChem CID 61039506) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[2-(oxolan-2-yl)ethylamino]propoxy]benzonitrile.
| Compound Name | 2-[2-hydroxy-3-[2-(oxolan-2-yl)ethylamino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 61039506 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[2-hydroxy-3-[2-(oxolan-2-yl)ethylamino]propoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCC(O)CNCCC1CCCO1 |
| InChI | InChI=1S/C16H22N2O3/c17-10-13-4-1-2-6-16(13)21-12-14(19)11-18-8-7-15-5-3-9-20-15/h1-2,4,6,14-15,18-19H,3,5,7-9,11-12H2 |
| InChIKey | OAQZPMGPLBTTQE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|