C13H15NO2 — CID 65161585
2-[2-(oxolan-2-yl)ethoxy]benzonitrile (PubChem CID 65161585) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[2-(oxolan-2-yl)ethoxy]benzonitrile.
| Compound Name | 2-[2-(oxolan-2-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 65161585 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-[2-(oxolan-2-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCC1CCCO1 |
| InChI | InChI=1S/C13H15NO2/c14-10-11-4-1-2-6-13(11)16-9-7-12-5-3-8-15-12/h1-2,4,6,12H,3,5,7-9H2 |
| InChIKey | CYFGBBVKLKUXSV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |