C16H18N2O5 — CID 2372728
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 2372728) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 2372728 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(2-cyanophenoxy)acetate |
| SMILES | N#Cc1ccccc1OCC(=O)OCC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H18N2O5/c17-8-12-4-1-2-6-14(12)22-11-16(20)23-10-15(19)18-9-13-5-3-7-21-13/h1-2,4,6,13H,3,5,7,9-11H2,(H,18,19)/t13-/m1/s1 |
| InChIKey | QHTLXKIXAKLURF-CYBMUJFWSA-N |
| XLogP | 0.78 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |