C15H18FNO5 — CID 2369928
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(3-fluorophenoxy)acetate (PubChem CID 2369928) has the molecular formula C15H18FNO5 and a molecular weight of 311.31 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(3-fluorophenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 2369928 |
| Molecular Formula | C15H18FNO5 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(3-fluorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cccc(F)c1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C15H18FNO5/c16-11-3-1-4-12(7-11)21-10-15(19)22-9-14(18)17-8-13-5-2-6-20-13/h1,3-4,7,13H,2,5-6,8-10H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | PHYKZIWEVCLTFR-CYBMUJFWSA-N |
| XLogP | 1.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |