C18H23NO6 — CID 9291487
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 9291487) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 9291487 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H23NO6/c1-2-16(20)13-5-7-14(8-6-13)24-12-18(22)25-11-17(21)19-10-15-4-3-9-23-15/h5-8,15H,2-4,9-12H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | GNUKDGRWNOYWFU-OAHLLOKOSA-N |
| XLogP | 1.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |