C19H25NO5 — CID 7855189
[2-(cyclohexylamino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 7855189) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 7855189 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H25NO5/c1-2-17(21)14-8-10-16(11-9-14)24-13-19(23)25-12-18(22)20-15-6-4-3-5-7-15/h8-11,15H,2-7,12-13H2,1H3,(H,20,22) |
| InChIKey | PZPBHCWBUNVHBO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |