C20H29NO4 — CID 23884530
[2-(cyclooctylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate (PubChem CID 23884530) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 23884530 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(C)cc(OCC(=O)OCC(=O)NC2CCCCCCC2)c1 |
| InChI | InChI=1S/C20H29NO4/c1-15-10-16(2)12-18(11-15)24-14-20(23)25-13-19(22)21-17-8-6-4-3-5-7-9-17/h10-12,17H,3-9,13-14H2,1-2H3,(H,21,22) |
| InChIKey | XWUYKYIXJGHIMI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |