C21H31NO4 — CID 24817967
[2-(cyclooctylamino)-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate (PubChem CID 24817967) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate |
|---|---|
| PubChem CID | 24817967 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate |
| SMILES | Cc1cc(C)c(OCC(=O)OCC(=O)NC2CCCCCCC2)c(C)c1 |
| InChI | InChI=1S/C21H31NO4/c1-15-11-16(2)21(17(3)12-15)26-14-20(24)25-13-19(23)22-18-9-7-5-4-6-8-10-18/h11-12,18H,4-10,13-14H2,1-3H3,(H,22,23) |
| InChIKey | CWLADNIKGRPWNC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |