C18H25NO3 — CID 78760578
N-(cyclohexylmethyl)-2-(4-propanoylphenoxy)acetamide (PubChem CID 78760578) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(4-propanoylphenoxy)acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-(4-propanoylphenoxy)acetamide |
|---|---|
| PubChem CID | 78760578 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(4-propanoylphenoxy)acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)NCC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-2-17(20)15-8-10-16(11-9-15)22-13-18(21)19-12-14-6-4-3-5-7-14/h8-11,14H,2-7,12-13H2,1H3,(H,19,21) |
| InChIKey | XFGWCOSKKXHFMR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |