C19H27NO4 — CID 2603569
[2-(cyclohexylmethylamino)-2-oxoethyl] 4-propan-2-yloxybenzoate (PubChem CID 2603569) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 4-propan-2-yloxybenzoate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 2603569 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)OCC(=O)NCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-14(2)24-17-10-8-16(9-11-17)19(22)23-13-18(21)20-12-15-6-4-3-5-7-15/h8-11,14-15H,3-7,12-13H2,1-2H3,(H,20,21) |
| InChIKey | WNALLXPBSRHMET-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |