C16H20ClNO5 — CID 9404420
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-chloro-3-methylphenoxy)acetate (PubChem CID 9404420) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-chloro-3-methylphenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-chloro-3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 9404420 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-chloro-3-methylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)OCC(=O)NC[C@H]2CCCO2)ccc1Cl |
| InChI | InChI=1S/C16H20ClNO5/c1-11-7-12(4-5-14(11)17)22-10-16(20)23-9-15(19)18-8-13-3-2-6-21-13/h4-5,7,13H,2-3,6,8-10H2,1H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | MTHUDHKUXADFGZ-CYBMUJFWSA-N |
| XLogP | 1.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |