C18H20IN5O3 — CID 70683109
1-[2-[[(2S)-3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-(6-iodo-3-pyridinyl)urea (PubChem CID 70683109) has the molecular formula C18H20IN5O3 and a molecular weight of 481.29 g/mol. Its IUPAC name is 1-[2-[[(2S)-3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-(6-iodo-3-pyridinyl)urea.
| Compound Name | 1-[2-[[(2S)-3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-(6-iodo-3-pyridinyl)urea |
|---|---|
| PubChem CID | 70683109 |
| Molecular Formula | C18H20IN5O3 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 1-[2-[[(2S)-3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-(6-iodo-3-pyridinyl)urea |
| SMILES | N#Cc1ccccc1OC[C@@H](O)CNCCNC(=O)Nc1ccc(I)nc1 |
| InChI | InChI=1S/C18H20IN5O3/c19-17-6-5-14(10-23-17)24-18(26)22-8-7-21-11-15(25)12-27-16-4-2-1-3-13(16)9-20/h1-6,10,15,21,25H,7-8,11-12H2,(H2,22,24,26)/t15-/m0/s1 |
| InChIKey | URUALXCCJRUDGI-HNNXBMFYSA-N |
| XLogP | 1.71 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|