C30H34Cl2F3N3O9 — CID 67753618
4-[2-[4-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,2,4-trimethyl-6-(trifluoromethyl)pyridine-3,5-dicarboxylic acid;hydrochloride (PubChem CID 67753618) has the molecular formula C30H34Cl2F3N3O9 and a molecular weight of 708.51 g/mol. Its IUPAC name is 4-[2-[4-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,2,4-trimethyl-6-(trifluoromethyl)pyridine-3,5-dicarboxylic acid;hydrochloride.
| Compound Name | 4-[2-[4-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,2,4-trimethyl-6-(trifluoromethyl)pyridine-3,5-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67753618 |
| Molecular Formula | C30H34Cl2F3N3O9 |
| Molecular Weight | 708.51 g/mol |
| Exact Mass | 707.16 |
| IUPAC Name | 4-[2-[4-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,2,4-trimethyl-6-(trifluoromethyl)pyridine-3,5-dicarboxylic acid;hydrochloride |
| SMILES | CC1=C(C(=O)O)C(C)(c2cc([N+](=O)[O-])ccc2OCCCCNCC(O)COc2ccccc2Cl)C(C(=O)O)=C(C(F)(F)F)N1C.Cl |
| InChI | InChI=1S/C30H33ClF3N3O9.ClH/c1-17-24(27(39)40)29(2,25(28(41)42)26(36(17)3)30(32,33)34)20-14-18(37(43)44)10-11-22(20)45-13-7-6-12-35-15-19(38)16-46-23-9-5-4-8-21(23)31;/h4-5,8-11,14,19,35,38H,6-7,12-13,15-16H2,1-3H3,(H,39,40)(H,41,42);1H |
| InChIKey | SLQRUDVIVCJWNB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 171.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|