C21H27N3O7 — CID 23162071
4-[2-(4-aminobutoxy)-5-nitrophenyl]-1,2,4,6-tetramethylpyridine-3,5-dicarboxylic acid (PubChem CID 23162071) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is 4-[2-(4-aminobutoxy)-5-nitrophenyl]-1,2,4,6-tetramethylpyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-(4-aminobutoxy)-5-nitrophenyl]-1,2,4,6-tetramethylpyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 23162071 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[2-(4-aminobutoxy)-5-nitrophenyl]-1,2,4,6-tetramethylpyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(C)(c2cc([N+](=O)[O-])ccc2OCCCCN)C(C(=O)O)=C(C)N1C |
| InChI | InChI=1S/C21H27N3O7/c1-12-17(19(25)26)21(3,18(20(27)28)13(2)23(12)4)15-11-14(24(29)30)7-8-16(15)31-10-6-5-9-22/h7-8,11H,5-6,9-10,22H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | QPHIYUPQOCOGRV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|