C17H18N2O7 — CID 57014684
2-(hydroxymethyl)-1,4,6-trimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylic acid (PubChem CID 57014684) has the molecular formula C17H18N2O7 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,4,6-trimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-(hydroxymethyl)-1,4,6-trimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57014684 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-(hydroxymethyl)-1,4,6-trimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(C)(c2ccccc2[N+](=O)[O-])C(C(=O)O)=C(CO)N1C |
| InChI | InChI=1S/C17H18N2O7/c1-9-13(15(21)22)17(2,10-6-4-5-7-11(10)19(25)26)14(16(23)24)12(8-20)18(9)3/h4-7,20H,8H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | PXCSRJIKLCEAKB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 141.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|