C14H15NO6 — CID 102153179
trans-2-O-ethyl 1-O-methyl (1R,2R)-1-(2-nitrophenyl)cyclopropane-1,2-dicarboxylate (PubChem CID 102153179) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is trans-2-O-ethyl 1-O-methyl (1R,2R)-1-(2-nitrophenyl)cyclopropane-1,2-dicarboxylate.
| Compound Name | trans-2-O-ethyl 1-O-methyl (1R,2R)-1-(2-nitrophenyl)cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102153179 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | trans-2-O-ethyl 1-O-methyl (1R,2R)-1-(2-nitrophenyl)cyclopropane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@]1(C(=O)OC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15NO6/c1-3-21-12(16)10-8-14(10,13(17)20-2)9-6-4-5-7-11(9)15(18)19/h4-7,10H,3,8H2,1-2H3/t10-,14-/m0/s1 |
| InChIKey | KHHHLQFXAQGLCF-HZMBPMFUSA-N |
| XLogP | 1.59 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|