C17H20FNO6 — CID 122392422
1-O-tert-butyl 2-O-ethyl 1-(3-fluoro-4-nitrophenyl)cyclopropane-1,2-dicarboxylate (PubChem CID 122392422) has the molecular formula C17H20FNO6 and a molecular weight of 353.35 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 1-(3-fluoro-4-nitrophenyl)cyclopropane-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 1-(3-fluoro-4-nitrophenyl)cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122392422 |
| Molecular Formula | C17H20FNO6 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 1-(3-fluoro-4-nitrophenyl)cyclopropane-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC1(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C17H20FNO6/c1-5-24-14(20)11-9-17(11,15(21)25-16(2,3)4)10-6-7-13(19(22)23)12(18)8-10/h6-8,11H,5,9H2,1-4H3 |
| InChIKey | XMBUDARXUOWKCR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|