C17H24FN3O6 — CID 122596196
tert-butyl N-[2-[(3-fluoro-4-nitrophenyl)methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate (PubChem CID 122596196) has the molecular formula C17H24FN3O6 and a molecular weight of 385.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-fluoro-4-nitrophenyl)methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(3-fluoro-4-nitrophenyl)methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 122596196 |
| Molecular Formula | C17H24FN3O6 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl N-[2-[(3-fluoro-4-nitrophenyl)methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)C(=O)OCc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C17H24FN3O6/c1-17(2,3)27-16(23)20(5)9-8-19(4)15(22)26-11-12-6-7-14(21(24)25)13(18)10-12/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | ASXPEACOBMJITE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|