C15H23N3O6S — CID 52872862
tert-butyl N-methyl-N-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]carbamate (PubChem CID 52872862) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 52872862 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]carbamate |
| SMILES | CN(CCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O6S/c1-15(2,3)24-14(19)17(4)10-9-16-25(22,23)11-12-5-7-13(8-6-12)18(20)21/h5-8,16H,9-11H2,1-4H3 |
| InChIKey | JVGCHOCYTRPBNL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|