C18H27N3O7S — CID 99793865
tert-butyl N-[(2S,3R)-3-methyl-1-[(4-nitrophenyl)methylsulfonylamino]-1-oxopentan-2-yl]carbamate (PubChem CID 99793865) has the molecular formula C18H27N3O7S and a molecular weight of 429.50 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-methyl-1-[(4-nitrophenyl)methylsulfonylamino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-methyl-1-[(4-nitrophenyl)methylsulfonylamino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 99793865 |
| Molecular Formula | C18H27N3O7S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-methyl-1-[(4-nitrophenyl)methylsulfonylamino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H27N3O7S/c1-6-12(2)15(19-17(23)28-18(3,4)5)16(22)20-29(26,27)11-13-7-9-14(10-8-13)21(24)25/h7-10,12,15H,6,11H2,1-5H3,(H,19,23)(H,20,22)/t12-,15+/m1/s1 |
| InChIKey | PMWVNNIFRMEUMU-DOMZBBRYSA-N |
| XLogP | 2.48 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|