C16H23N3O5 — CID 47028678
tert-butyl N-methyl-N-[3-[(4-nitrobenzoyl)amino]propyl]carbamate (PubChem CID 47028678) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-[(4-nitrobenzoyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-[(4-nitrobenzoyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 47028678 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl N-methyl-N-[3-[(4-nitrobenzoyl)amino]propyl]carbamate |
| SMILES | CN(CCCNC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(21)18(4)11-5-10-17-14(20)12-6-8-13(9-7-12)19(22)23/h6-9H,5,10-11H2,1-4H3,(H,17,20) |
| InChIKey | HHODBFCQUHWDJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|