C14H18N4O6 — CID 118158794
tert-butyl N-[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl]carbamate (PubChem CID 118158794) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 118158794 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | tert-butyl N-[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N4O6/c1-14(2,3)24-13(21)15-8-11(19)16-17-12(20)9-4-6-10(7-5-9)18(22)23/h4-7H,8H2,1-3H3,(H,15,21)(H,16,19)(H,17,20) |
| InChIKey | OJXHJXTYGYWSAO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|