C23H32N4O9 — CID 6736185
ditert-butyl 2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioate (PubChem CID 6736185) has the molecular formula C23H32N4O9 and a molecular weight of 508.53 g/mol. Its IUPAC name is ditert-butyl 2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioate.
| Compound Name | ditert-butyl 2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioate |
|---|---|
| PubChem CID | 6736185 |
| Molecular Formula | C23H32N4O9 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | ditert-butyl 2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)CNC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N4O9/c1-22(2,3)35-19(30)11-16(21(32)36-23(4,5)6)26-18(29)13-24-17(28)12-25-20(31)14-7-9-15(10-8-14)27(33)34/h7-10,16H,11-13H2,1-6H3,(H,24,28)(H,25,31)(H,26,29) |
| InChIKey | FYIULYWGBIXAIA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 183.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|