C25H23N3O7S — CID 2968573
[4-(4-nitrophenyl)sulfanylphenyl]methyl 2-[[2-[(4-methoxybenzoyl)amino]acetyl]amino]acetate (PubChem CID 2968573) has the molecular formula C25H23N3O7S and a molecular weight of 509.54 g/mol. Its IUPAC name is [4-(4-nitrophenyl)sulfanylphenyl]methyl 2-[[2-[(4-methoxybenzoyl)amino]acetyl]amino]acetate.
| Compound Name | [4-(4-nitrophenyl)sulfanylphenyl]methyl 2-[[2-[(4-methoxybenzoyl)amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 2968573 |
| Molecular Formula | C25H23N3O7S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [4-(4-nitrophenyl)sulfanylphenyl]methyl 2-[[2-[(4-methoxybenzoyl)amino]acetyl]amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)NCC(=O)OCc2ccc(Sc3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O7S/c1-34-20-8-4-18(5-9-20)25(31)27-14-23(29)26-15-24(30)35-16-17-2-10-21(11-3-17)36-22-12-6-19(7-13-22)28(32)33/h2-13H,14-16H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | XNKHURDUGNFFTC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|