C29H27N5O7 — CID 6734308
benzyl 3-(1H-indol-3-yl)-2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoate (PubChem CID 6734308) has the molecular formula C29H27N5O7 and a molecular weight of 557.56 g/mol. Its IUPAC name is benzyl 3-(1H-indol-3-yl)-2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoate.
| Compound Name | benzyl 3-(1H-indol-3-yl)-2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 6734308 |
| Molecular Formula | C29H27N5O7 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | benzyl 3-(1H-indol-3-yl)-2-[[2-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoate |
| SMILES | O=C(CNC(=O)c1ccc([N+](=O)[O-])cc1)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H27N5O7/c35-26(16-32-28(37)20-10-12-22(13-11-20)34(39)40)31-17-27(36)33-25(29(38)41-18-19-6-2-1-3-7-19)14-21-15-30-24-9-5-4-8-23(21)24/h1-13,15,25,30H,14,16-18H2,(H,31,35)(H,32,37)(H,33,36) |
| InChIKey | ZCYWYBNFOHZHAQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|