C22H31NO5 — CID 129077492
ditert-butyl 2-[1-(4-acetylphenyl)ethenylamino]butanedioate (PubChem CID 129077492) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is ditert-butyl 2-[1-(4-acetylphenyl)ethenylamino]butanedioate.
| Compound Name | ditert-butyl 2-[1-(4-acetylphenyl)ethenylamino]butanedioate |
|---|---|
| PubChem CID | 129077492 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | ditert-butyl 2-[1-(4-acetylphenyl)ethenylamino]butanedioate |
| SMILES | C=C(NC(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H31NO5/c1-14(16-9-11-17(12-10-16)15(2)24)23-18(20(26)28-22(6,7)8)13-19(25)27-21(3,4)5/h9-12,18,23H,1,13H2,2-8H3 |
| InChIKey | HVSBRCUVEQTEBR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |