C32H60N2O11 — CID 155093722
ditert-butyl 2-[2-[2-[2-[2-[[1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate (PubChem CID 155093722) has the molecular formula C32H60N2O11 and a molecular weight of 648.84 g/mol. Its IUPAC name is ditert-butyl 2-[2-[2-[2-[2-[[1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate.
| Compound Name | ditert-butyl 2-[2-[2-[2-[2-[[1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate |
|---|---|
| PubChem CID | 155093722 |
| Molecular Formula | C32H60N2O11 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | ditert-butyl 2-[2-[2-[2-[2-[[1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CC(NCCOCCOCCOCCNC(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H60N2O11/c1-29(2,3)42-25(35)21-23(27(37)44-31(7,8)9)33-13-15-39-17-19-41-20-18-40-16-14-34-24(28(38)45-32(10,11)12)22-26(36)43-30(4,5)6/h23-24,33-34H,13-22H2,1-12H3 |
| InChIKey | AFKLWSICJMUGDI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|