C14H27NO5 — CID 86629018
ditert-butyl (2S)-2-(2-hydroxyethylamino)butanedioate (PubChem CID 86629018) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is ditert-butyl (2S)-2-(2-hydroxyethylamino)butanedioate.
| Compound Name | ditert-butyl (2S)-2-(2-hydroxyethylamino)butanedioate |
|---|---|
| PubChem CID | 86629018 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | ditert-butyl (2S)-2-(2-hydroxyethylamino)butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NCCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO5/c1-13(2,3)19-11(17)9-10(15-7-8-16)12(18)20-14(4,5)6/h10,15-16H,7-9H2,1-6H3/t10-/m0/s1 |
| InChIKey | ZCDFCIYGYFXHHV-JTQLQIEISA-N |
| XLogP | 1.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |