C9H18O4P+ — CID 123691775
[1-methoxy-4-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]phosphanium (PubChem CID 123691775) has the molecular formula C9H18O4P+ and a molecular weight of 221.21 g/mol. Its IUPAC name is [1-methoxy-4-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]phosphanium.
| Compound Name | [1-methoxy-4-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]phosphanium |
|---|---|
| PubChem CID | 123691775 |
| Molecular Formula | C9H18O4P+ |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | [1-methoxy-4-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]phosphanium |
| SMILES | COC(=O)C([PH3+])CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H17O4P/c1-9(2,3)13-7(10)5-6(14)8(11)12-4/h6H,5,14H2,1-4H3/p+1 |
| InChIKey | AIOVUMQPIWPHAK-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|